| Name | morantel tartrate |
| Synonyms | RUMATEL morantel tartrate MORANTEL TARTRATE Morantel Tartarte Salt MORANTEL TARTRATE HYDRATE Morantel Tartrate (100 mg) 1,4,5,6-tetrahydro-1-methyl-2-(2-(3-methyl-2-thienyl)vinyl)pyrimidine tartrate 1,4,5,6-Tetrahydro-1-methyl-2-[(E)-2-(3-methyl-2-thienyl)ethenyl]pyrimidine·L-tartaric acid 1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-1,4,5,6-tetrahydropyrimidine 2,3-dihydroxybutanedioate (salt) |
| CAS | 26155-31-7 |
| EINECS | 247-481-5 |
| InChI | InChI=1/C12H16N2S.C4H6O6/c1-10-6-9-15-11(10)4-5-12-13-7-3-8-14(12)2;5-1(3(7)8)2(6)4(9)10/h4-6,9H,3,7-8H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/b5-4+;/t;1-,2-/m.1/s1 |
| Molecular Formula | C16H22N2O6S |
| Molar Mass | 370.42 |
| Melting Point | 164 - 168°C |
| Boling Point | 334.6°C at 760 mmHg |
| Flash Point | 156.1°C |
| Solubility | H2O: soluble4.0ML, very slightly hazy, light yellow (200 mg + 4.0 mL H2O) |
| Vapor Presure | 0.000127mmHg at 25°C |
| Appearance | neat |
| Color | light yellow |
| BRN | 8739506 |
| Storage Condition | Refrigerator |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | UW0246000 |
| HS Code | 2934990002 |
| biological activity | Morantel tartaric acid is a broad-spectrum intestinal insect repellent with good effect and low toxicity. |